| Name | 4,6-Diamino-2-mercaptopyrimidine |
| Synonyms | AKOS USSH-4110073 6-AMINO-2-THIOCYTOSINE 4,6-Diamino-2-thiopyrimdine 4,6-Diamino-2-pyrimidinethiol 4,6-Diamino-2-mercaptopyrimidine 4,6-DIAMINO-2-MERCAPTOPYRIMIDINE 2-Mercapto-4,6-diaminopyrimidine 4,6-diamino-2(1h)-pyrimidinethion 4,6-diaminopyrimidine-2(1H)-thione 4,6-Diamino-2(1H)-pyrimidinethione 2(1h)-pyrimidinethione, 4,6-diamino- 2(1H)-Pyrimidinethione, 4,6-diamino- |
| CAS | 1004-39-3 |
| EINECS | 213-721-2 |
| InChI | InChI=1S/C4H6N4S/c5-2-1-3(6)8-4(9)7-2/h1H,(H5,5,6,7,8,9) |
| InChIKey | QCAWOHUJKPKOMD-UHFFFAOYSA-N |
| Molecular Formula | C4H6N4S |
| Molar Mass | 142.18 |
| Density | 1.78±0.1 g/cm3(Predicted) |
| Melting Point | >300°C(lit.) |
| Boling Point | 289.1±43.0 °C(Predicted) |
| Flash Point | 128.7 °C |
| Solubility | 1 M NaOH: soluble2% |
| Appearance | Solid |
| Color | Pale Beige to Light Brown |
| BRN | 124937 |
| pKa | 11.81±0.10(Predicted) |
| Storage Condition | Store below +30°C. |
| Stability | Hygroscopic |
| MDL | MFCD00006078 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
| RTECS | MB7660000 |
| HS Code | 2933 59 95 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |