| Name | 4,6-dimethoxy-1H-indole |
| Synonyms | AKOS JY2083231 4,6-DIMETHOXYINDOLE 4,6-dimethoxy-1H-indole 4,6-DIMETHOXY-1H-INDOLE 1H-Indole, 4,6-diMethoxy- 1H-indole, 4,6-dimethoxy- |
| CAS | 23659-87-2 |
| InChI | InChI=1/C10H11NO2/c1-12-7-5-9-8(3-4-11-9)10(6-7)13-2/h3-6,11H,1-2H3 |
| Molecular Formula | C10H11NO2 |
| Molar Mass | 177.2 |
| Density | 1.182±0.06 g/cm3(Predicted) |
| Melting Point | 122-124°C |
| Boling Point | 343.8±22.0 °C(Predicted) |
| Flash Point | 125.7°C |
| Vapor Presure | 0.000137mmHg at 25°C |
| pKa | 17.45±0.30(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.608 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| Hazard Class | IRRITANT |