| Name | 1-bromo-4-pentylbenzene |
| Synonyms | 4-BROMOAMYLBENZENE 4-BROMOPENTYLBENZENE 4-n-Amylbromobenzene 4-PENTYLBROMOBENZENE 1-AMYL-4-BROMOBENZENE p-Bromo-n-pentylbenzene 4-Bromo-1-n-amylbenzene 4-BROMO-N-PENTYLBENZENE 1-BROMO-4-PENTYLBENZENE 1-bromo-4-pentylbenzene 4-(N-PENTYL)BROMOBENZENE 1-(4-Bromophenyl)pentane 1-Bromo-4-(pent-1-yl)benzene 1-Bromo-4-N-Propylbenzene,3PbrC9H9Br 4-Pentylbromobenzene1-Amyl-4-bromobenzene 4-Pentylbromobenzene,1-Bromo-4-pentylbenzene |
| CAS | 51554-95-1 |
| EINECS | 472-220-9 |
| InChI | InChI=1/C11H15Br/c1-2-3-4-5-10-6-8-11(12)9-7-10/h6-9H,2-5H2,1H3 |
| InChIKey | SGCJPYYTVBHQGE-UHFFFAOYSA-N |
| Molecular Formula | C11H15Br |
| Molar Mass | 227.14 |
| Density | 1.272 g/mL at 25 °C (lit.) |
| Boling Point | 203-204 °C (lit.) |
| Flash Point | 192°F |
| Solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| Vapor Presure | 0.0184mmHg at 25°C |
| Appearance | Oil |
| Specific Gravity | 1.21 |
| Color | Clear Colorless |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.5260(lit.) |
| MDL | MFCD00061113 |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| UN IDs | NA 1993 / PGIII |
| WGK Germany | 3 |
| HS Code | 29039990 |
| Hazard Class | IRRITANT |
Mark Xi,Xn
Hazard code 20/21/22-36/37/38
Safety instructions 24/25-36-26
WGK Germany 3
Hazard Note Irritant
HazardClass IRRITANT
liquid crystal monomer synthesis raw materials; Pharmaceutical synthesis raw materials.
| use | liquid crystal monomer synthesis raw materials; Pharmaceutical synthesis raw materials |