| Name | 4-Choro-2(3H)-benzothiazolone |
| Synonyms | CHBT 4-CHLOROBENZOTHIAZOLONE 4-Choro-2-benzothiazolone 4-CHARO-2(3H)BENZOTHIAZOLONE 4-Choro-2(3H)-benzothiazolone 4-choro-2(3h)-benzothiazolone 4-Chlorobenzothiazol-2(3H)-one 4-Chloro-2(3H)-benzothiazolone 4-chlorobenzothiazol-2(3H)-one 2(3H)-Benzothiazolone, 4-chloro- 2-HYDROXY-4-CHLORO BENZOTHIOZOLE 4-chloro-1,3-benzothiazol-2(3H)-one 2(3H)-Benzothiazolone,4-chloro-(9CI) |
| CAS | 39205-62-4 |
| EINECS | 254-354-8 |
| InChI | InChI=1/C7H4ClNOS/c8-4-2-1-3-5-6(4)9-7(10)11-5/h1-3H,(H,9,10) |
| Molecular Formula | C7H4ClNOS |
| Molar Mass | 185.63 |
| Density | 1.515±0.06 g/cm3(Predicted) |
| Melting Point | 204-205°C |
| Boling Point | 394.2°C at 760 mmHg |
| Flash Point | 192.2°C |
| Vapor Presure | 8.85E-07mmHg at 25°C |
| pKa | 9.35±0.20(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.669 |
| Physical and Chemical Properties | This product is a white needle-like solid, m.p.200 ~ 202 ℃, soluble in ethanol and dichloroethane and other organic solvents, insoluble in water. |
| HS Code | 29342000 |
| Use | 4-Chlorobenzothiazolone is an intermediate of herbicide herbicides. |
| production method | its preparation method is to put 2-amino -4-chlorobenzothiazole hydrobromide, dichloroethane, hydrochloric acid and water into the reaction kettle, stir at a temperature of 15-20 ℃, add sodium nitrite solution dropwise, continue stirring for 3 hours after adding, preset stratification, and dissolving and dissolving the oil layer at normal pressure to evaporate dichloroethane, ethanol is added while it is hot, and 30% hydrochloric acid and sulfuric acid are added dropwise at the same time. After dropwise addition, the reaction is refluxed for 3 hours. After the reaction is finished, the product is cooled, filtered and dried. |