| Name | 4-IODO-2-FLUORO-3-FORMYLPYRIDINE |
| Synonyms | 2-fluoro-4-iodonicotaldehyde 2-FLUORO-4-IODONICOTINALDEHYDE 2-FLUORO-3-FORMYL-4-IODOPYRIDINE 4-IODO-2-FLUORO-3-FORMYLPYRIDINE 2-Fluoro-4-iodopyridine-3-carbaldehyde 2-fluoro-4-iodo-pyridine-3-carbaldehyde 2-Fluoro-4-iodo-3-pyridinecarboxaldehyde 2 - F -3 - aldehyde -4 - iodine pyridine 2-FLUORO-4-IODOPYRIDINE-3-CARBOXALDEHYDE |
| CAS | 153034-82-3 |
| InChI | InChI=1/C6H3FINO/c7-6-4(3-10)5(8)1-2-9-6/h1-3H |
| InChIKey | VONGIOGTLFSXDE-UHFFFAOYSA-N |
| Molecular Formula | C6H3FINO |
| Molar Mass | 251 |
| Density | 2.081±0.06 g/cm3(Predicted) |
| Melting Point | 78-80℃ |
| Boling Point | 304.2±42.0 °C(Predicted) |
| Flash Point | 137.793°C |
| Vapor Presure | 0.001mmHg at 25°C |
| pKa | -3.62±0.18(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| Refractive Index | 1.65 |
| MDL | MFCD03095290 |
| Risk Codes | 22 - Harmful if swallowed |
| Hazard Note | Irritant |
| Introduction | 2-fluoro-3-aldo-4-iodopyridine is a heterocyclic organic substance, which can be made of 2-fluoropyridine as the reaction raw material and reacted with iodine to prepare the intermediate 2-fluoro-4-iodopyridine, which is further prepared by reacting with ethyl formate, it can be used to prepare compound 2-fluoro-4-iodo-3-picolinic acid. |
| Application | 2-fluoro-3-aldo-4-iodopyridine is a heterocyclic organic compound and can be used as an intermediate in pharmaceutical synthesis. |