| Name | 4-Methylbenzophenone |
| Synonyms | P-BENZOYL TOLUENE Photoinitiator-4MBP P-METHYLBENZOPHENONE 4-Methylbenzophenone 4-METHYLBENZOPHENONE 4-methlybenzophenone PHENYL P-TOLYL KETONE PHENYL 4-TOLYL KETONE P-TOLYL PHENYL KETONE Phenyl p-tolyl ketone (4-methylphenyl)phenyl-methanon (4-METHYLPHENYL)PHENYLMETHANONE (4-Methylphenyl)phenylmethanone cyclohexyl(4-methylphenyl)methanone 4-Methylbenzophenone,(Phenyl p-tolyl ketone) |
| CAS | 134-84-9 |
| EINECS | 205-159-1 |
| InChI | InChI=1/C14H18O/c1-11-7-9-13(10-8-11)14(15)12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3 |
| InChIKey | WXPWZZHELZEVPO-UHFFFAOYSA-N |
| Molecular Formula | C14H12O |
| Molar Mass | 196.24 |
| Density | 0.9926 |
| Melting Point | 56.5-57 °C (lit.) |
| Boling Point | 326 °C (lit.) |
| Flash Point | 143 °C |
| Water Solubility | Insoluble in water. |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Vapor Presure | 0.059Pa at 25℃ |
| Appearance | White crystal |
| Color | White to beige |
| Merck | 14,7317 |
| BRN | 1909310 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5920 (estimate) |
| MDL | MFCD00008553 |
| Physical and Chemical Properties | White crystals. Melting point 56-57 °c. |
| Use | Used as ultraviolet absorber, pharmaceutical intermediates |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R22 - Harmful if swallowed R36/38 - Irritating to eyes and skin. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| RTECS | DJ1750000 |
| TSCA | Yes |
| HS Code | 29143990 |
| Hazard Note | Harmful/Irritant |
| LogP | 3.69 at 25℃ |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| Use | Used as UV absorber and pharmaceutical intermediate UV curable coatings and inks |