| Name | 4-Nitrophenylhydrazine |
| Synonyms | Nitrophenylhydrazine 4-Nitrophenylhydrazine 4-Nitrophenyl hydrazine (4-nitrophenyl)hydrazinium chloride |
| CAS | 100-16-3 |
| EINECS | 202-824-8 |
| InChI | InChI=1/C6H7N3O2/c7-8-5-1-3-6(4-2-5)9(10)11/h1-4,8H,7H2 |
| Molecular Formula | C6H7N3O2 |
| Molar Mass | 153.139 |
| Density | 1.419g/cm3 |
| Melting Point | 154-158℃ |
| Boling Point | 344°C at 760 mmHg |
| Flash Point | 161.8°C |
| Water Solubility | soluble in hot water |
| Vapor Presure | 6.79E-05mmHg at 25°C |
| Refractive Index | 1.691 |
| Physical and Chemical Properties | Melting point 154-158°C water-soluble in hot water |
| Use | Used as a reagent for testing aldehyde and ketone sugars |
| Hazard Symbols | F - Flammable![]() Xn - Harmful ![]() |
| Risk Codes | R11 - Highly Flammable R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. R5 - Heating may cause an explosion |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| UN IDs | UN 3376 |
Nitrophenylhydrazine, chemical formula C6H7N3O2, is an organic compound.
Use:
Nitrophenylhydrazine has many uses in the chemical industry, mainly including the following aspects:
1. basic raw materials: can be used to produce dyes, fluorescent dyes and organic synthesis intermediates and other chemicals.
2. explosives: can be used for the preparation of explosives, pyrotechnical products and propellants and other explosives.
Preparation Method:
The preparation of nitrophenylhydrazine is usually achieved by nitric acid esterification. Specific steps are as follows:
1. Dissolve phenylhydrazine in nitric acid.
2. Under appropriate temperature and reaction time, nitrous acid in nitric acid reacts with phenylhydrazine to generate nitrophenylhydrazine.
3. Filtration and washing give the final product.
Safety Information:
nitrophenylhydrazine is a flammable compound, which is easy to cause explosion when exposed to open flame or high temperature. Therefore, proper fire and explosion prevention measures are required when storing and handling nitrophenylhydrazine. In addition, nitrophenylhydrazine is also irritating and has a certain damaging effect on the eyes, skin and respiratory tract. It is necessary to wear appropriate personal protective equipment during operation. In the use and disposal, to strictly abide by the relevant safety regulations and operating guidelines, to ensure the safety of people and the environment.