| Name | 4-n-Octylacetophenone |
| Synonyms | NSC 168987 P-OCTYLACETOPHENONE p-Octylacetophenone TIMTEC-BB SBB008323 4'-Octylacetophenone 4-n-Octylacetophenone p-n-Octylacetophenone 4'-N-OCTYLACETOPHENONE 4'-N-Octylacetophenone Acetophenone, 4'-octyl- 1-(4-octylphenyl)ethanone 1-(4-octylphenyl)-ethanon 1-(4-OCTYL-PHENYL)ETHANONE Ethanone, 1-(4-octylphenyl)- |
| CAS | 10541-56-7 |
| InChI | InChI=1/C16H24O/c1-3-4-5-6-7-8-9-15-10-12-16(13-11-15)14(2)17/h10-13H,3-9H2,1-2H3 |
| Molecular Formula | C16H24O |
| Molar Mass | 232.36 |
| Density | 0.919 |
| Melting Point | 18 °C |
| Boling Point | 152-153°C 1mm |
| Flash Point | 152-153°C/1mm |
| Vapor Presure | 8.38E-05mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.4970 (estimate) |
| MDL | MFCD00143208 |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| TSCA | Yes |
| HS Code | 29143990 |
| overview | p-octyl acetophenone can be used as an intermediate in pharmaceutical synthesis. If you inhale p-octyl acetophenone, please move the patient to fresh air. If the skin is in contact with the skin, remove the contaminated clothes, rinse the skin thoroughly with soapy water and clear water, and see a doctor if you feel uncomfortable. If you are in contact with clear eyes, you should separate the eyelids, rinse with flowing water or normal saline, and see a doctor immediately. If you eat, rinse your mouth immediately, prohibit vomiting, and see a doctor immediately. |
| EPA chemical information | information provided by: ofmpub.epa.gov (external link) |