| Name | 5-Bromoindole-3-acetic acid |
| Synonyms | 5-Bromo-3-indoleacetic acid 5-Bromoindole-3-acetic acid 5-BROMOINDOLE-3-ACETIC ACID (5-bromo-1H-indol-3-yl)acetate 1H-Indole-3-acetic acid, 5-bromo- (5-bromo-1H-indol-3-yl)acetic acid (5-BROMO-1H-INDOL-3-YL)-ACETIC ACID 5-BROMOINDOLE-3-ACETIC ACID (5BrIAA) 2-(5-broMo-1H-indol-3-yl)acetic acid |
| CAS | 40432-84-6 |
| EINECS | 254-917-8 |
| InChI | InChI=1/C10H8BrNO2/c11-7-1-2-9-8(4-7)6(5-12-9)3-10(13)14/h1-2,4-5,12H,3H2,(H,13,14)/p-1 |
| Molecular Formula | C10H8BrNO2 |
| Molar Mass | 254.08 |
| Density | 1.6254 (rough estimate) |
| Melting Point | 143-145 °C (lit.) |
| Boling Point | 466.0±30.0 °C(Predicted) |
| Flash Point | 235.6°C |
| Vapor Presure | 1.75E-09mmHg at 25°C |
| Appearance | Crystalline Powder |
| Color | Off-white to beige |
| pKa | 4.36±0.30(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.6320 (estimate) |
| MDL | MFCD00005637 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S22 - Do not breathe dust. |
| WGK Germany | 3 |
| HS Code | 29339990 |