| Name | 4-(dicyclohexylphosphanyl)-N,N-dimethylaniline |
| Synonyms | Dicyclohexyl(4-dimethylaminophenyl)phosphine 4-dicyclohexylphosphanyl-N,N-dimethylaniline 4-(Dicyclohexylphosphino)-N,N-dimethylaniline p-(Dicyclohexylphosphenyl)-N,N-dimethylaniline 4-(dicyclohexylphosphanyl)-N,N-dimethylaniline DICYCLOHEXYL(4-(N,N-DIMETHYLAMINO)PHENYL)PHOSPHIN Dicyclohexyl(4-(N,N-dimethylamino)phenyl)phosphine [4-(N,N-dimethylamino)phenyl]dicyclohexylphosphine Benzenamine, 4-(dicyclohexylphosphino)-N,N-dimethyl- |
| CAS | 40438-64-0 |
| InChI | InChI=1/C20H32NP/c1-21(2)17-13-15-20(16-14-17)22(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h13-16,18-19H,3-12H2,1-2H3 |
| Molecular Formula | C20H32NP |
| Molar Mass | 317.45 |
| Melting Point | 103-108°C |
| Boling Point | 446.5±28.0 °C(Predicted) |
| Flash Point | 223.8°C |
| Vapor Presure | 3.62E-08mmHg at 25°C |
| pKa | 4.66±0.24(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |