| Name | Succinic dihydrazide Butanedioyl dihydrazide |
| Synonyms | 377 Succinhydrazide AKOS BBS-00001037 butanedihydrazide BUTANEDIOHYDRAZIDE BIO-FARMA BF003442 Succinic dihydrazide LABOTEST-BB LT00068494 Butanedioyl dihydrazide Succinic acid hydrazide Succinic acid dihydrazide BUTANEDIOIC ACID DIHYDRAZIDE Succinic dihydrazide, (Succinic acid dihydrazide) |
| CAS | 4146-43-4 |
| EINECS | 223-970-9 |
| InChI | InChI=1/C4H10N4O2/c5-7-3(9)1-2-4(10)8-6/h1-2,5-6H2,(H,7,9)(H,8,10) |
| Molecular Formula | C4H10N4O2 |
| Molar Mass | 146.15 |
| Density | 1.284±0.06 g/cm3(Predicted) |
| Melting Point | 170-171 °C (lit.) |
| Boling Point | 540.2±33.0 °C(Predicted) |
| Flash Point | 280.5°C |
| Water Solubility | Soluble in water |
| Vapor Presure | 9.79E-12mmHg at 25°C |
| Appearance | Solid |
| Color | White to Almost white |
| pKa | 12.62±0.35(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.525 |
| MDL | MFCD00007613 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | WM7500000 |
| HS Code | 29280000 |
| Hazard Class | IRRITANT |
| Toxicity | LD50 intraperitoneal in mouse: > 1gm/kg |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| application | succinyl hydrazide is a white crystalline powder, water-based coating additive, epoxy crosslinking agent, aldehyde remover, textile additive and biochemical reagent, which can be mainly used in laboratory organic synthesis process and chemical and pharmaceutical production research and development process. |