| Name | 5,6-dichloronicotinic acid |
| Synonyms | 5,6-Dichloro TIMTEC-BB SBB003623 5,6-DICHLORONICOTINIC ACID 5,6-dichloronicotinic acid 5,6-dichloro nicotinic acid 5,6-DICHLOROPYRIDINE-3-CARBOXYLIC ACID 5,6-Dichloropyridine-3-carboxylic acid 5,6-DICHLORO-3-PYRIDINECARBOXYLIC ACID 5,6-Dichloronicotinic acid, 5,6-Dichloropyridine-3-carboxylic acid |
| CAS | 41667-95-2 |
| EINECS | 609-951-1 |
| InChI | InChI=1/C6H3Cl2NO2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2H,(H,10,11) |
| InChIKey | RNRLTTNKVLFZJS-UHFFFAOYSA-N |
| Molecular Formula | C6H3Cl2NO2 |
| Molar Mass | 192 |
| Density | 1.612±0.06 g/cm3(Predicted) |
| Melting Point | 164-168°C(lit.) |
| Boling Point | 342.1±37.0 °C(Predicted) |
| Flash Point | 160.7°C |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 2.96E-05mmHg at 25°C |
| Appearance | White-like crystalline powder |
| Color | White to beige to tan |
| BRN | 383740 |
| pKa | 2.87±0.10(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.605 |
| MDL | MFCD00075181 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Hazard Class | IRRITANT |
| uses | the effect of 5, 6-dichlorotinic acid on a multifunctional agent for the treatment of Alzheimer's disease. |
| application | 5, 6-dichlorocicotinic acid is an organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory organic synthesis process and chemical medicine research and development process. |