| Name | 2,4,6-Trimethylbenzyl alcohol |
| Synonyms | MESITYL ALCOHOL MESITYLMETHANOL RARECHEM AL BD 0049 2,4,6-Trimethylbenzylalkohol 2,4,6-trimethyl-benzylalcoho 2,4,6-Trimethylbenzyl alcohol 2,4,6-trimethyl-benzenemethano (2,4,6-Trimethyl-phenyl)-methanol 1-(HYDROXYMETHYL)-2,4,6-TRIMETHYLBENZENE |
| CAS | 4170-90-5 |
| EINECS | 224-032-1 |
| InChI | InChI=1/C10H14O/c1-7-4-8(2)10(6-11)9(3)5-7/h4-5,11H,6H2,1-3H3 |
| Molecular Formula | C10H14O |
| Molar Mass | 150.22 |
| Density | 0.9108 (rough estimate) |
| Melting Point | 87-89 °C (lit.) |
| Boling Point | 140 °C/15 mmHg (lit.) |
| Flash Point | 140°C/15mm |
| Vapor Presure | 0.0282mmHg at 25°C |
| BRN | 1862608 |
| pKa | 14.51±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.4763 (estimate) |
| MDL | MFCD00014422 |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 2 |
| RTECS | DP1402000 |
| HS Code | 29062990 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| Uses | 2,4, 6-trimethylbenzyl alcohol is an alcohol organic substance and can be used as an organic reagent. |