| Name | 4-Di-p-tolylaminobenzaldehyde |
| Synonyms | 4-di-p-Tolylamino-benzaldehyd 4-Di-p-tolylaminobenzaldehyde 4-(Di-p-Tlylamino)benzaldehyde 4-Di-p-tolylamino-benzaldehyde 4-(DI-P-TOLYLAMINO)BENZALDEHYDE p-[N,N-Di-p-tolylamino]benzaldehyde 4-(N,N-Di-p-tolylamino)benzaldehyde 4-FORMYL-4',4''-DIMETHYLTRIPHENYLAMINE 4-[BIS(4-METHYLPHENYL)AMINO]BENZALDEHYDE 4-[bis(4-methylphenyl)amino]benzaldehyde 4,4'-Bis(4-methylphenyl)-aminobenzoaldehyde |
| CAS | 42906-19-4 |
| EINECS | 255-996-1 |
| InChI | InChI=1/C21H19NO/c1-16-3-9-19(10-4-16)22(20-11-5-17(2)6-12-20)21-13-7-18(15-23)8-14-21/h3-15H,1-2H3 |
| Molecular Formula | C21H19NO |
| Molar Mass | 301.38 |
| Density | 1.138±0.06 g/cm3(Predicted) |
| Melting Point | 109 °C |
| Boling Point | 470.5±45.0 °C(Predicted) |
| Flash Point | 182.4°C |
| Solubility | almost transparency in hot Acetonitrile |
| Vapor Presure | 5.03E-09mmHg at 25°C |
| Appearance | powder to crystal |
| Color | Light yellow to Amber to Dark green |
| pKa | -4.76±0.50(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Refractive Index | 1.649 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |