42949-24-6
5-Azaadamantan-2-one
CAS: 42949-24-6
Molecular Formula: C9H13NO
42949-24-6 - Names and Identifiers
| Name | 5-Azaadamantan-2-one |
| Synonyms | 1-Azaadamantan-4-one 5-Azaadamantan-2-one 1-Aza-4-oxoadamantane 1-Azatricyclo[3.3.1.1(3,7) 1-Azatricyclo[3.3.1.13,7]decan-4-one 1-Azatricyclo[3.3.1.13,7]decan-4-one 1-azatricyclo[3.3.1.1~3,7~]decan-4-one 1-Azatricyclo[3.3.1.1(3,7)]decan-4-one 1-azatricyclo[3.3.1.13,7 ]decane-4-one |
| CAS | 42949-24-6 |
| InChI | InChI=1/C9H13NO/c11-9-7-1-6-2-8(9)5-10(3-6)4-7/h6-8H,1-5H2 |
42949-24-6 - Physico-chemical Properties
| Molecular Formula | C9H13NO |
| Molar Mass | 151.21 |
| Density | 1.19 |
| Boling Point | 265 ºC |
| Flash Point | 106 ºC |
| Vapor Presure | 0.01mmHg at 25°C |
| Storage Condition | 2-8°C |
| Refractive Index | 1.569 |
42949-24-6 - Introduction
5-Azaadamantan-2-one(5-Azaadamantan-2-one) is an organic compound with the molecular formula C6H9NO. The following are some of the properties, uses, preparation and safety information of the compound:
Nature:
1. Appearance: 5-Azaadamantan-2-one is a white crystalline solid or crystalline powder.
2. melting point: about 40-44 degrees Celsius.
3. Boiling point: about 171 degrees Celsius.
4. density: about 1.08 g/ml.
5. Not soluble in water at room temperature, but soluble in organic solvents such as alcohol, ether, etc.
Use:
5-Azaadamantan-2-one has important applications in the field of organic synthesis:
1. As an intermediate for the synthesis of other organic compounds, it is used for the synthesis of functional organic compounds, such as drugs, dyes, pesticides, etc.
2. In medicinal chemistry, 5-Azaadamantan-2-one can be used to synthesize hydrogenated artery research tools to study the effects of drugs on the cardiovascular system.
3. In the field of organic optoelectronics, the compound can be used to synthesize luminescent materials, fluorescent probes, etc.
Preparation Method:
5-Azaadamantan-2-one can be prepared in a variety of ways. Common methods include:
1. By reacting the precursor compound of 5-Azaadamantan-2-one (such as 5-azadamantane) with an appropriate keto-based reagent to generate the target product.
2. Synthesized by chemical modification or functional group transformation of other corresponding compounds.
Safety Information:
1. 5-Azaadamantan-2-one is an organic compound with certain toxicity. It is necessary to wear protective gloves and glasses during operation.
2. avoid inhalation and contact, avoid direct exposure to the skin, eyes or mucous membranes.
3. storage should be kept sealed, away from oxidants and fire sources.
Nature:
1. Appearance: 5-Azaadamantan-2-one is a white crystalline solid or crystalline powder.
2. melting point: about 40-44 degrees Celsius.
3. Boiling point: about 171 degrees Celsius.
4. density: about 1.08 g/ml.
5. Not soluble in water at room temperature, but soluble in organic solvents such as alcohol, ether, etc.
Use:
5-Azaadamantan-2-one has important applications in the field of organic synthesis:
1. As an intermediate for the synthesis of other organic compounds, it is used for the synthesis of functional organic compounds, such as drugs, dyes, pesticides, etc.
2. In medicinal chemistry, 5-Azaadamantan-2-one can be used to synthesize hydrogenated artery research tools to study the effects of drugs on the cardiovascular system.
3. In the field of organic optoelectronics, the compound can be used to synthesize luminescent materials, fluorescent probes, etc.
Preparation Method:
5-Azaadamantan-2-one can be prepared in a variety of ways. Common methods include:
1. By reacting the precursor compound of 5-Azaadamantan-2-one (such as 5-azadamantane) with an appropriate keto-based reagent to generate the target product.
2. Synthesized by chemical modification or functional group transformation of other corresponding compounds.
Safety Information:
1. 5-Azaadamantan-2-one is an organic compound with certain toxicity. It is necessary to wear protective gloves and glasses during operation.
2. avoid inhalation and contact, avoid direct exposure to the skin, eyes or mucous membranes.
3. storage should be kept sealed, away from oxidants and fire sources.
Last Update：2024-04-09 02:00:46
Supplier List
Spot supply
Product Name: 1-Aza-4-oxoadamantane Request for quotationCAS: 42949-24-6
Tel: 400-968-2212
Email: 3623107365@qq.com
Mobile: 18916960931
QQ: 3623107365
Wechat: 18916960931
Spot supply
Product Name: 1-Aza-4-oxoadamantane Visit Supplier Webpage Request for quotationCAS: 42949-24-6
Tel: +86-400-900-4166
Email: product@acmec-e.com
Mobile: +86-18621343501
QQ: 2881950922
Wechat: 18621343501
WhatsApp: +86-18621343501
Product Name: 1-Aza-4-oxoadamantane Visit Supplier Webpage Request for quotation
CAS: 42949-24-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
CAS: 42949-24-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Spot supply
Product Name: 1-Aza-4-oxoadamantane Request for quotationCAS: 42949-24-6
Tel: 400-968-2212
Email: 3623107365@qq.com
Mobile: 18916960931
QQ: 3623107365
Wechat: 18916960931
Spot supply
Product Name: 1-Aza-4-oxoadamantane Visit Supplier Webpage Request for quotationCAS: 42949-24-6
Tel: +86-400-900-4166
Email: product@acmec-e.com
Mobile: +86-18621343501
QQ: 2881950922
Wechat: 18621343501
WhatsApp: +86-18621343501
Product Name: 1-Aza-4-oxoadamantane Visit Supplier Webpage Request for quotation
CAS: 42949-24-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
CAS: 42949-24-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
View History