| Name | 4-piperidinium-4-ylmorpholin-4-ium |
| Synonyms | AKOS BB-9182 CHEMBRDG-BB 4004473 TIMTEC-BB SBB010091 4-(PIPERIDIN-4-YL)-MORPHOLINE morpholine 2,2,2-trifluoroacetate 4-piperidinium-4-ylmorpholin-4-ium 4-(4-Piperidinyl)Morpholine trifluoroacetate 4-(4-piperidinyl)Morpholine2,2,2-trifluoroacetate 4-(piperidin-4-yl)Morpholine 2,2,2-trifluoroacetate |
| CAS | 436099-97-7 |
| InChI | InChI=1/C9H18N2O/c1-3-10-4-2-9(1)11-5-7-12-8-6-11/h9-10H,1-8H2/p+2 |
| Molecular Formula | C9H18N2O |
| Molar Mass | 170.25 |
| Melting Point | 40-43°C(lit.) |
| Boling Point | 100-115°C0.15-0.20mm Hg(lit.) |
| Flash Point | >230°F |
| Vapor Presure | 0.0155mmHg at 25°C |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| Hazard Class | IRRITANT |