4394-05-2 - Names and Identifiers
| Name | nixylic acid
|
| Synonyms | nixylic acid NIXYLIC ACID UNII-1ZI8H16Z5I Acido nixilico [INN-Spanish] Acidum nixylicum [INN-Latin] Acide nixylique [INN-French] 2-(2,3-Xylidino)nicotinic acid 2-[2,3-Dimethylanilino] nicotinic acid 2-[(2,3-dimethylphenyl)amino]nicotinic acid 2-(2,3-Dimethyl-phenylamino)-nicotinic acid 2-(2,3-dimethylanilino)pyridine-3-carboxylic acid 2-[(2,3-Dimethylphenyl)amino]-3-pyridinecarboxylic acid 2-[(2,3-Dimethylphenyl)amino]pyridine-3-carboxylic acid 2-[(2,3-dimethylphenyl)amino]pyridine-3-carboxylic acid
|
| CAS | 4394-05-2
|
| EINECS | 224-517-8 |
| InChI | InChI=1/C14H14N2O2/c1-9-5-3-7-12(10(9)2)16-13-11(14(17)18)6-4-8-15-13/h3-8H,1-2H3,(H,15,16)(H,17,18) |
4394-05-2 - Physico-chemical Properties
| Molecular Formula | C14H14N2O2
|
| Molar Mass | 242.27 |
| Density | 1.250±0.06 g/cm3(Predicted) |
| Melting Point | 248 °C |
| Boling Point | 403.2±45.0 °C(Predicted) |
| Flash Point | 197.7°C |
| Vapor Presure | 3.17E-07mmHg at 25°C |
| pKa | 1.76±0.36(Predicted) |
| Refractive Index | 1.645 |
4394-05-2 - Introduction
nixylic acid is an organic compound with the chemical formula C6H4(CH3)CO2H. The following is an introduction to the nature, use, preparation and safety information of nixylic acid:
Nature:
-Appearance: nixylic acid is colorless crystal or white crystalline powder.
-Solubility: It can be dissolved in water, and more easily dissolved in alcohol and ether solvents.
-Melting point: Its melting point is about 155-157 degrees Celsius.
-Chemical properties: nixylic acid is acidic and can react with alkali to generate the corresponding salt.
Use:
-Industrial use: nixylic acid can be used as an intermediate in organic synthesis, such as for the synthesis of dyes, pigments and fragrances.
-Medical use: nixylic acid can also be used to prepare drugs, with certain biological activity.
Preparation Method:
- nixylic acid can be prepared by oxidation of p-toluic acid or p-toluic aldehyde.
Safety Information:
- nixylic acid is a relatively low toxicity compound, which is generally considered to be less harmful to humans and the environment.
-When contacting nixylic acid, care should be taken to avoid inhaling its dust or solution, and avoid direct contact with skin and eyes.
-In the use of nixylic acid, need to take appropriate protective measures, such as wearing gloves, masks and protective glasses.
Last Update:2024-04-09 02:00:46