| Name | 1-(4-Fluorophenyl)-2-propanone |
| Synonyms | 4-FLUOROPHENYLACETONE 4-Fluorophenylacetone 4'-FLUOROPHENYLACETONE (P-FLUOROPHENYL)ACETONE 1-(4-Fluorophenyl)acetone 1-ACETONYL-4-FLUOROBENZENE P-FLUORO BENZYL METHYL KETONE 1-(4-Fluorophenyl)-2-propanone 1-(4-FLUOROPHENYL)-2-PROPANONE 1-(4-fluorophenyl)propan-2-one 2-Propanone, 1-(4-fluorophenyl)- |
| CAS | 459-03-0 |
| EINECS | 207-284-7 |
| InChI | InChI=1/C9H9FO/c1-7(11)6-8-2-4-9(10)5-3-8/h2-5H,6H2,1H3 |
| Molecular Formula | C9H9FO |
| Molar Mass | 152.17 |
| Density | 1.139 g/mL at 25 °C (lit.) |
| Boling Point | 106-107 °C/18 mmHg (lit.) |
| Flash Point | 197°F |
| Water Solubility | insoluble |
| Vapor Presure | 0.128mmHg at 25°C |
| Appearance | clear liquid |
| Specific Gravity | 1.139 |
| Color | Light yellow to Yellow to Orange |
| BRN | 1936697 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.496(lit.) |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29147090 |
| Hazard Note | Flammable |
| Hazard Class | IRRITANT, FLAMMABLE |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |