| Name | Julolidine |
| Synonyms | Julolidine 2,3,6,7-Tetrahydro-1H,5H-benzo(i,j)quinolizine 2,3,6,7-tetrahydro-1H,5H-pyrido[3,2,1-ij]quinoline |
| CAS | 479-59-4 |
| EINECS | 207-535-0 |
| InChI | InChI=1/C12H15N/c1-4-10-6-2-8-13-9-3-7-11(5-1)12(10)13/h1,4-5H,2-3,6-9H2 |
| InChIKey | DZFWNZJKBJOGFQ-UHFFFAOYSA-N |
| Molecular Formula | C12H15N |
| Molar Mass | 173.25 |
| Density | 1.1g/cm3 |
| Melting Point | 34-36℃ |
| Boling Point | 311.7°C at 760 mmHg |
| Flash Point | 129.6°C |
| Water Solubility | Soluble in toluene. Insoluble in water. |
| Vapor Presure | 0.000554mmHg at 25°C |
| Appearance | Form Liquid After Melting, color Clear yellow to orange-brown |
| pKa | 6.54±0.20(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.609 |
| Physical and Chemical Properties | Chemical properties white crystal. Melting point 34-36 ℃(97% commodity). Its bromate ([83647-41-7]) has a melting point of 239-242°C. |
| Use | Uses for organic synthesis. |
| Risk Codes | 52/53 - Harmful to aquatic organisms, may cause long-term adverse effects in the aquatic environment. |
| Safety Description | S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29339900 |
| Sensitivity | Air Sensitive |
| BRN | 139925 |
| NIST chemical information | Julolidine(479-59-4) |
| EPA chemical information | 1H,5H-Benzo[ij]quinolizine, 2,3,6,7-tetrahydro- (479-59-4) |