| Name | ARISTOLOCHIC ACID C |
| Synonyms | ARISTOLOCHIC ACID C Aristolochic acid IIIa ARISTOLOCHIC ACID C(SH) Aristolochic Acid Impurity C 10-Hydroxy-6-nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylic acid 6-Nitro-10-hydroxyphenanthro[3,4-d]-1,3-dioxole-5-carboxylic acid 10-Hydroxy-6-nitrophenanthro[3,4-d]-1,3-dioxole-5-carboxylic acid 10-hydroxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid 10-hydroxy-6-nitro-naphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid phenanthro[3,4-d]-1,3-dioxole-5-carboxylic acid, 10-hydroxy-6-nitro- |
| CAS | 4849-90-5 |
| InChI | InChI=1/C16H9NO7/c18-8-2-1-7-3-11(17(21)22)13-10(16(19)20)5-12-15(24-6-23-12)14(13)9(7)4-8/h1-5,18H,6H2,(H,19,20) |
| Molecular Formula | C16H9NO7 |
| Molar Mass | 327.25 |
| Density | 1.707±0.06 g/cm3(Predicted) |
| Melting Point | 287~292℃ |
| Boling Point | 658.7±55.0 °C(Predicted) |
| Flash Point | 352.1°C |
| Solubility | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| Vapor Presure | 3.02E-18mmHg at 25°C |
| Appearance | White-like powder |
| Color | Dark Orange |
| pKa | 3.01±0.20(Predicted) |
| Storage Condition | -20°C Freezer |
| Refractive Index | 1.82 |
| MDL | MFCD03093714 |
| Physical and Chemical Properties | White powder, soluble in methanol, ethanol, DMSO and other organic solvents, derived from Aristolochia, Asarum. |
| Reference Show more | 1. [IF=7.46] Si-Qi Wu et al."Gold nanoclusters-based paper sensor for the visualized detection of nephrotoxic aristolochic acids."Sensor Actuat B-Chem. 2021 Aug;340:129792 |
| biological activity | Aristolochic acid C is a derivative of aristolochic acid (Aristolochic acid). Aristolochic acid is an inhibitor of phospholipase A (phospholipase A2,PLA2), which acts on Arabidopsis thaliana and can destroy the periplasminal microtubule array of interphase cells and inhibit root growth. |
| use | aristolochic acid c has anti-tumor, antibacterial, anti-inflammatory, analgesic and anti-fertility effects. used for content determination/identification/pharmacological experiment, etc. |