| Name | 3-(2-Hydroxyphenyl)propionic acid |
| Synonyms | MELILOTIC ACID hydrocoumaric acid 2-HYDROXYHYDROCINNAMIC ACID 2-Hydroxyhydrocinnamic acid 3-(2-hydroxyphenyl)propanoate 3-(2-HYDROXYPHENYL)PROPANOIC ACID 3-(2-HYDROXYPHENYL)PROPIONIC ACID 3-(2-Hydroxyphenyl)propionic acid 3-(O-HYDROXYPHENYL) PROPIONIC ACID BETA-(O-HYDROXYPHENYL)PROPIONIC ACID |
| CAS | 495-78-3 |
| InChI | InChI=1/C9H10O3/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4,10H,5-6H2,(H,11,12)/p-1 |
| InChIKey | CJBDUOMQLFKVQC-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
| Molar Mass | 166.17 |
| Density | 1.260±0.06 g/cm3(Predicted) |
| Melting Point | 86-89°C(lit.) |
| Boling Point | 335.9±17.0 °C(Predicted) |
| Flash Point | 171.2°C |
| Solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 4.56E-05mmHg at 25°C |
| Appearance | Solid |
| Color | Pale Yellow |
| BRN | 1681601 |
| pKa | 4.75±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29182900 |
| Hazard Class | IRRITANT |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| biological activity | 3-(2-Hydroxyphenyl)propanoic acid (Melilotic acid, Melilotate, 2-hydroxybenzenepropanoic acid) is an endogenous metabolite. |