| Name | Glycyl-L-Histidyl-L-Lysine |
| Synonyms | Iamin Ahk-cu NSC 379527 Gly-his-lys Copper(II)ghk Copper Peptide Copper peptide Glycylhistidyllysine (Gly-His-Lys)2Cu.xHAc GHK Cu Copper Peptide Glycyl-histidyl-lysine Glycyl-L-Histidyl-L-Lysine L-Lysine,glycyl-L-histidyl- Liver Cell Growth Factor(GHK) Copper glycyl-histidyl-lysine Copper Peptide powder (GHK-cu) GHK Cu Copper Peptide GHK.Cu GHK-Cu N(2)-(N-Glycyl-L-histidyl)-L-lysine |
| CAS | 49557-75-7 |
| EINECS | 1592732-453-0 |
| InChI | InChI=1/C14H24N6O4/c15-4-2-1-3-10(14(23)24)20-13(22)11(19-12(21)6-16)5-9-7-17-8-18-9/h7-8,10-11H,1-6,15-16H2,(H,17,18)(H,19,21)(H,20,22)(H,23,24) |
| Molecular Formula | C14H24N6O4 |
| Molar Mass | 340.38 |
| Density | 1.324 |
| Melting Point | >144°C (dec.) |
| Boling Point | 831.0±65.0 °C(Predicted) |
| Flash Point | 456.4°C |
| Solubility | Aqueous Acid (Slightly), DMSO (Slightly) |
| Vapor Presure | 2.86E-29mmHg at 25°C |
| Appearance | Solid |
| Color | Off-White |
| pKa | 3.11±0.10(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Stability | Hygroscopic |
| Refractive Index | 1.582 |
| Physical and Chemical Properties | Sansheng peptide: anti-carbonylation, protect collagen from damage by activated carbon groups, promote the growth of type III collagen, anti-oxidation, anti-saccharification, mainly used in cosmetics. |
| Introduction | Tripeptide (copper peptide) is formed by three amino acids. Tripeptide is also called blue copper peptide; glycyl-L-histidyl-L-Lysine. Tripeptide is a ternary molecule formed by three amino acids and two peptide bonds. It can effectively prevent the nerve conduction of an acetylcholine substance, relax muscles, and improve dynamic wrinkles. |
| physical and chemical properties | tripeptide: anti-carbonylation, protect collagen from damage by activated carbon groups, promote the growth of type III collagen, antioxidant, anti-saccharification, mainly used in cosmetics. |
| mechanism of action | tripeptide acts on cells, increases the vitality of collagen cells, accelerates firepower production, and can improve dynamic wrinkles. |
| efficacy | the efficacy of tripeptide is as follows: tripeptide has the effects of anti-carbonylation, protecting collagen from damage by activated carbon groups, promoting the growth of type III collagen, anti-oxidation and anti-saccharification. |
| Effect | Sansheng peptide can effectively complex and transport copper elements to play a corresponding role. For example, the complexed copper peptide can effectively stimulate fibroblasts (fibroblasts) The biosynthesis of collagen in China promotes the rapid healing of wounds; copper peptide can also effectively prevent the nerve conduction of acetylcholine substances, thereby relaxing muscles, improve dynamic wrinkles and other effects. Sansheng peptide is now widely used in cosmetic additives. |