| Name | 5-Aminooxindole |
| Synonyms | 5-Aminooxindole CHEMBRDG-BB 4006397 TIMTEC-BB SBB010120 5-aminoindolin-2-one 5-amino-2-indolinone 5-Amino-1,3-dihydro-indol... 5-Amino-1,3-dihydro-indol-2-one 5-amino-1,3-dihydro-2H-indol-2-one 5-amino-3,3a-dihydro-1H-indol-2(7aH)-one 5-Amino-1,3-dihydro-2H-indol-2-one, 5-Aminoindolin-2-one |
| CAS | 20876-36-2 |
| InChI | InChI=1/C8H8N2O/c9-6-1-2-7-5(3-6)4-8(11)10-7/h1-3H,4,9H2,(H,10,11) |
| Molecular Formula | C8H8N2O |
| Molar Mass | 148.16 |
| Density | 1.307±0.06 g/cm3(Predicted) |
| Melting Point | 182-186°C |
| Boling Point | 416.8±45.0 °C(Predicted) |
| Flash Point | 205.8°C |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 3.73E-07mmHg at 25°C |
| Appearance | Yellow to brown crystalline powder |
| Color | Dark Green to Brown |
| pKa | 13.91±0.20(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| Refractive Index | 1.653 |
| MDL | MFCD02179603 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| Hazard Class | IRRITANT |