| Name | 5-Hydroxy-1-indanone |
| Synonyms | 5-hydry-1-indanone IFLAB-BB F2108-0144 5-Hydroxy-1-indanone 5-Hydroxyindan-1-one 5-HYDROXY-1-INDANONE 5-Hydroxyl-1-indanone 5-hydroxy-2,3-dihydroinden-1-one 5-hydroxy-2,3-dihydro-1H-inden-1-one 2,3-Dihydro-5-hydroxy-1H-inden-1-one |
| CAS | 3470-49-3 |
| InChI | InChI=1/C9H8O2/c10-7-2-3-8-6(5-7)1-4-9(8)11/h2-3,5,10H,1,4H2 |
| InChIKey | ZRKQOVXGDIZYDS-UHFFFAOYSA-N |
| Molecular Formula | C9H8O2 |
| Molar Mass | 148.16 |
| Density | 1.305±0.06 g/cm3(Predicted) |
| Melting Point | 175 °C (dec.) (lit.) |
| Boling Point | 251 °C |
| Flash Point | 146.376°C |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Light yellow to Light orange |
| pKa | 8.15±0.20(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.631 |
| MDL | MFCD00857527 |
| Physical and Chemical Properties | Appearance: light yellow crystal Melting Point: 153-155 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S27 - Take off immediately all contaminated clothing. |
| WGK Germany | 3 |
| HS Code | 29145090 |
| Hazard Note | Irritant |