5-benzyl-3,3-dimethyl-3,4-dihydro-2H-pyrrole - Names and Identifiers
Name | 5-Benzyl-3,4-dihydro-3,3-dimethyl-2H-pyrrole
|
Synonyms | 5-benzyl-3,3-dimethyl-2,4-dihydropyrrole 5-benzyl-3,3-dimethyl-3,4-dihydro-2H-pyrrole 5-Benzyl-3,3-dimethyl-3,4-dihydro-2H-pyrrole 5-Benzyl-3,4-dihydro-3,3-dimethyl-2H-pyrrole 2H-Pyrrole,3,4-dihydro-3,3-diMethyl-5-(phenylMethyl)- 2H-pyrrole, 3,4-dihydro-3,3-dimethyl-5-(phenylmethyl)-
|
CAS | 116673-95-1
|
InChI | InChI=1/C13H17N/c1-13(2)9-12(14-10-13)8-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3 |
5-benzyl-3,3-dimethyl-3,4-dihydro-2H-pyrrole - Physico-chemical Properties
Molecular Formula | C13H17N
|
Molar Mass | 187.28 |
Density | 0.96 |
Boling Point | 81-82 °C(Press: 0.1 Torr) |
Flash Point | 109.789°C |
Vapor Presure | 0.011mmHg at 25°C |
pKa | 7.90±0.40(Predicted) |
Storage Condition | 2-8°C |
Refractive Index | 1.54 |
5-benzyl-3,3-dimethyl-3,4-dihydro-2H-pyrrole - Introduction
5-benzyl -3, 4-dihydro-3, 3-dimethyl-2H-pyrrole, also known as piperic acid, is an organic compound. The following is an introduction to its nature, use, preparation and safety information:
Nature:
1. Appearance: White crystalline solid.
2. molecular formula: C15H19NO2.
3. Molecular weight: 245.32g/mol.
4. Melting point: 115-116°C.
5. Solubility: Soluble in most organic solvents, such as ethanol, acetone, etc.
Use:
1. Chemical intermediate: It can be used as an important intermediate for the synthesis of other organic compounds.
2. Drug research: Picolin has important research significance in the field of drug development and has broad application prospects.
Preparation Method:
The preparation of Pikolin can be carried out by the following steps:
1. Heat the terephthalic acid to its melting point.
2. Condensation reaction of molten terephthalic acid and potassium hydroxide in the reaction.
3. subjecting the reaction product to acidification, purification and other steps to obtain the final 5-benzyl -3, 4-dihydro-3, 3-dimethyl-2H-pyrrole product.
Safety Information:
1. there is a certain degree of irritation of picolin, contact with the skin may lead to skin allergies.
2. Avoid inhaling the steam of the powder or solution of Pikolin. It is recommended to wear appropriate protective equipment during operation.
3. storage should be away from the fire and oxidant, avoid exposure.
4. If contact with eyes or skin occurs, rinse immediately with plenty of water and seek medical attention immediately.
Last Update:2024-04-09 15:17:51