50638-47-6
4-bromo-2-chloroanisole
CAS: 50638-47-6
Molecular Formula: C7H6BrClO
50638-47-6 - Names and Identifiers
| Name | 4-bromo-2-chloroanisole |
| Synonyms | Chloro-4-bromoanisole 4-bromo-2-chloroanisole 2-Chloro-4-bromoanisole 4-BROMO-2-CHLOROANISOLE 3-Chloro-4-methoxyphenyl bromide 4-bromo-2-chloro-1-methoxybenzene 1-Bromo-3-chloro-4-methoxybenzene 2-chloro-4-Bromo-1-methoxy-benzene Benzene,4-bromo-2-chloro-1-methoxy- Methyl(2-chloro-4-bromophenyl) ether |
| CAS | 50638-47-6 |
| EINECS | 256-672-2 |
| InChI | InChI=1/C7H6BrClO/c1-10-7-3-2-5(8)4-6(7)9/h2-4H,1H3 |
50638-47-6 - Physico-chemical Properties
| Molecular Formula | C7H6BrClO |
| Molar Mass | 221.48 |
| Density | 1.564 |
| Melting Point | 68.5-70.5°C |
| Boling Point | 242℃ |
| Flash Point | 100℃ |
| Vapor Presure | 0.0538mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.556 |
50638-47-6 - Introduction
4-bromo-2-chrooanisole (4-bromo-2-chrooanisole) is an organic compound with the chemical formula C7H6BrClO.
Its main properties are as follows:
1. Appearance: colorless to light yellow solid.
2. solubility: soluble in organic solvents, such as alcohols and ethers.
3. melting point: about 37-39 ℃.
4. Boiling point: about 209-210 ℃.
The main uses of this compound include:
1. as an organic synthesis intermediate for the synthesis of other compounds.
2. in the field of medicine, can be used for the synthesis of certain drugs raw materials.
The method of preparing 4-bromo-2-chloroanisole generally comprises the following steps:
1. 2-chloroanisole and sodium nitrite are reacted to obtain p-nitroanisole.
2. p-nitroanisole reacts with cuprous chloride to obtain p-methoxyanisole.
3. Finally, p-methoxyanisole is reacted with bromine to give 4-bromo-2-chloroanisole.
Regarding safety information, 4-bromo-2-chloroanisole is an organic compound and the following precautions should be observed:
1. Avoid contact with skin, eyes and mucous membranes. In case of accidental contact, rinse immediately with plenty of water for 15 minutes and seek medical help.
2. when in use, should comply with protective measures, such as wearing protective glasses, gloves and protective clothing.
3. Store away from fire and heat sources, keep sealed, and place in a well-ventilated place.
Its main properties are as follows:
1. Appearance: colorless to light yellow solid.
2. solubility: soluble in organic solvents, such as alcohols and ethers.
3. melting point: about 37-39 ℃.
4. Boiling point: about 209-210 ℃.
The main uses of this compound include:
1. as an organic synthesis intermediate for the synthesis of other compounds.
2. in the field of medicine, can be used for the synthesis of certain drugs raw materials.
The method of preparing 4-bromo-2-chloroanisole generally comprises the following steps:
1. 2-chloroanisole and sodium nitrite are reacted to obtain p-nitroanisole.
2. p-nitroanisole reacts with cuprous chloride to obtain p-methoxyanisole.
3. Finally, p-methoxyanisole is reacted with bromine to give 4-bromo-2-chloroanisole.
Regarding safety information, 4-bromo-2-chloroanisole is an organic compound and the following precautions should be observed:
1. Avoid contact with skin, eyes and mucous membranes. In case of accidental contact, rinse immediately with plenty of water for 15 minutes and seek medical help.
2. when in use, should comply with protective measures, such as wearing protective glasses, gloves and protective clothing.
3. Store away from fire and heat sources, keep sealed, and place in a well-ventilated place.
Last Update：2024-04-09 21:00:56
Supplier List
Spot supply
Product Name: 4-Bromo-2-chloro-1-methoxybenzene Request for quotationCAS: 50638-47-6
Tel: 400-968-2212
Email: 3623107365@qq.com
Mobile: 18916960931
QQ: 3623107365
Wechat: 18916960931
Spot supply
Product Name: 4-Bromo-2-chloro-1-methoxybenzene Visit Supplier Webpage Request for quotationCAS: 50638-47-6
Tel: +86-18821248368
Email: Int06@meryer.com
Mobile: +86-18821248368
QQ: 495145328
WhatsApp: +86-18821248368
Spot supply
Product Name: 4-Bromo-2-chloro-1-methoxybenzene Visit Supplier Webpage Request for quotationCAS: 50638-47-6
Tel: +86-400-900-4166
Email: product@acmec-e.com
Mobile: +86-18621343501
QQ: 2881950922
Wechat: 18621343501
WhatsApp: +86-18621343501
Spot supply
Product Name: 4-Bromo-2-chloro-1-methoxybenzene Visit Supplier Webpage Request for quotationCAS: 50638-47-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Spot supply
Product Name: 4-Bromo-2-chloro-1-methoxybenzene Request for quotationCAS: 50638-47-6
Tel: 400-968-2212
Email: 3623107365@qq.com
Mobile: 18916960931
QQ: 3623107365
Wechat: 18916960931
Spot supply
Product Name: 4-Bromo-2-chloro-1-methoxybenzene Visit Supplier Webpage Request for quotationCAS: 50638-47-6
Tel: +86-18821248368
Email: Int06@meryer.com
Mobile: +86-18821248368
QQ: 495145328
WhatsApp: +86-18821248368
Spot supply
Product Name: 4-Bromo-2-chloro-1-methoxybenzene Visit Supplier Webpage Request for quotationCAS: 50638-47-6
Tel: +86-400-900-4166
Email: product@acmec-e.com
Mobile: +86-18621343501
QQ: 2881950922
Wechat: 18621343501
WhatsApp: +86-18621343501
Spot supply
Product Name: 4-Bromo-2-chloro-1-methoxybenzene Visit Supplier Webpage Request for quotationCAS: 50638-47-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
View History