| Name | 1-chloroethyl ethyl carbonate |
| Synonyms | 1-chlorobutyl carbonate 1-Chloroethylethylcarbonate 1-chloroethyl ethyl carbonate Ethyl-(1-chloroethyl)-carbonate (1S)-1-chloroethyl ethyl carbonate (1R)-1-chloroethyl ethyl carbonate 1-chloroethyl ethyl carbonate (JCC-3) Carbonic acid ethyl 1-chloroethyl ester Carbonic acid 1-chloroethyl ethyl ester 1-CHLOROETHYL CARBOXYLIC ACID ETHYL ESTER Carbonic Acid 1-Chloroethyl Ethyl Ester1-Chlorodiethyl Carbonate |
| CAS | 50893-36-2 |
| EINECS | 256-832-1 |
| InChI | InChI=1/C5H9ClO3/c1-3-8-5(7)9-4(2)6/h4H,3H2,1-2H3/t4-/m1/s1 |
| InChIKey | YVRGKFXJZCTTRB-UHFFFAOYSA-N |
| Molecular Formula | C5H9ClO3 |
| Molar Mass | 152.58 |
| Density | 1.136g/mLat 20°C(lit.) |
| Melting Point | 159-161°C |
| Boling Point | 159-161°C(lit.) |
| Flash Point | 65°C |
| Solubility | Chloroform |
| Vapor Presure | 4.42mmHg at 25°C |
| Appearance | Oil |
| Color | Colourless |
| BRN | 3536477 |
| Storage Condition | 2-8°C |
| Stability | Moisture Sensitive |
| Refractive Index | n20/D 1.413 |
| Use | For Candesartan Cilexetil, cefotiam Ester and other drug intermediates |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S28 - After contact with skin, wash immediately with plenty of soap-suds. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-21 |
| HS Code | 29209090 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| Use | Used as a pharmaceutical intermediate such as candisartan mexetil and cefotiam axetil |