| Name | 3-chloro-2-methoxy-aniline |
| Synonyms | 3-CHLORO-O-ANISIDINE 97 2-Methoxy-3-chloroaniline 3-chloro-2-methoxy-aniline Aniline, 3-chloro-2-methoxy- Benzenamine, 3-chloro-2-methoxy- 1-Amino-3-chloro-2-methoxybenzene 2-Amino-6-chloroanisole (3-Chloro-2-methoxyaniline) |
| CAS | 51114-68-2 |
| InChI | InChI=1/C7H8ClNO/c1-10-7-5(8)3-2-4-6(7)9/h2-4H,9H2,1H3 |
| Molecular Formula | C7H8ClNO |
| Molar Mass | 157.6 |
| Density | 1.234±0.06 g/cm3(Predicted) |
| Melting Point | 179-180℃ (Decomposition) |
| Boling Point | 112-116℃ (10 Torr) |
| Flash Point | 108.9°C |
| Vapor Presure | 0.0278mmHg at 25°C |
| pKa | 3.48±0.10(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.572 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| Hazard Note | Irritant |