| Name | Diacetyltartaricacid |
| Synonyms | Diacetyltartaricacid (R,R)-DIACETYLTARTARIC ACID (-)-DIACETYL-L-TARTARIC ACID (-)-Diacetyl-L-tartaric acid (-)-Di-O-acetyl-L-tartaric acid (+)-L-Tartaric acid 2,3-diacetate 2,3-bis(acetyloxy)butanedioic acid (-)-2-O,3-O-Diacetyl-L-tartaric acid [R(R*,R*)]-2,3-bis(acetoxy)succinic acid (2R,3R)-2,3-bis(acetyloxy)butanedioic acid |
| CAS | 51591-38-9 |
| EINECS | 257-303-8 |
| InChI | InChI=1/C8H10O8/c1-3(9)15-5(7(11)12)6(8(13)14)16-4(2)10/h5-6H,1-2H3,(H,11,12)(H,13,14)/t5-,6-/m1/s1 |
| Molecular Formula | C8H10O8 |
| Molar Mass | 234.16 |
| Density | 1.486±0.06 g/cm3(Predicted) |
| Melting Point | 120°C |
| Boling Point | 398.9±42.0 °C(Predicted) |
| Flash Point | 159.4°C |
| Solubility | almost transparency in Acetone |
| Vapor Presure | 1.77E-07mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Almost white |
| pKa | 2.12±0.25(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | -25 ° (C=10, Acetone |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |