| Name | 1,3-Diethyl-2-thiobarbituric acid |
| Synonyms | NSC 158284 THIOBARBITAL LABOTEST-BB LT00053456 1,3-Diethylthiobarbituric acid N,N'-Diethylthiobarbituric acid 1,3-Diethylthiobarbituric acid. 1,3-DIETHYL-2-THIOBARBITURIC ACID 1,3-Diethyl-2-thiobarbituric acid N,N'-Diethyl-2-thiobarbituric acid Barbituric acid, 1,3-diethyl-2-thio- (8CI) 1-3-DIETHYL-2-THIOBARBITURIC ACID*CRYSTA LLINE 5h)-pyrimidinedione,1,3-diethyldihydro-2-thioxo-6(1h 1,3-Diethyldihydro-2-thioxopyrimidine-4,6(1H,5H)-dione 1,3-diethyl-2-thioxodihydropyrimidine-4,6(1H,5H)-dione 1,3-diethyldihydro-2-thioxopyrimidine-4,6(1H,5H)-dione 4,6(1H,5H)-Pyrimidinedione, 1,3-diethyldihydro-2-thioxo- N-{2-[(3-methyl-1-phenyl-1H-pyrazol-5-yl)amino]phenyl}-4-nitrobenzamide |
| CAS | 5217-47-0 |
| EINECS | 226-010-7 |
| InChI | InChI=1/C23H19N5O3/c1-16-15-22(27(26-16)18-7-3-2-4-8-18)24-20-9-5-6-10-21(20)25-23(29)17-11-13-19(14-12-17)28(30)31/h2-15,24H,1H3,(H,25,29) |
| Molecular Formula | C8H12N2O2S |
| Molar Mass | 200.26 |
| Density | 1.29±0.1 g/cm3(Predicted) |
| Melting Point | 109-112 °C (lit.) |
| Boling Point | 273.4±23.0 °C(Predicted) |
| Flash Point | 287.2°C |
| Solubility | 1 M NaOH: soluble50mg/mL, clear, colorless to light yellow |
| Vapor Presure | 3.36E-12mmHg at 25°C |
| pKa | 5.48±0.20(Predicted) |
| Storage Condition | Hormones |
| Refractive Index | 1.67 |
| Hazard Symbols | T - Toxic![]() |
| Risk Codes | R25 - Toxic if swallowed R43 - May cause sensitization by skin contact |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S22 - Do not breathe dust. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S36/37 - Wear suitable protective clothing and gloves. |
| UN IDs | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HS Code | 29335400 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |