| Name | 2,3-Dibromosuccinic acid |
| Synonyms | Dibromosuccinicacid 2,3-Dibromosucinic Acid 2,3-Dibromosuccinic acid 2,3-Dibromo Dibutyric Acid Threo-2,3-Dibromobutanedioic meso-2,3-Dibromosuccinic acid (2R,3S)-2,3-dibromobutanedioate Threo-2,3-Dibromo Dibutyric acid Threo-2,3-Dibromobutanedioic acid (2R,3S)-2,3-dibromobutanedioic acid |
| CAS | 526-78-3 608-35-5 608-36-6 |
| EINECS | 208-396-9 |
| InChI | InChI=1/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10)/p-2/t1-,2+ |
| Molecular Formula | C4H4Br2O4 |
| Molar Mass | 275.88 |
| Melting Point | 255-260℃ |
| Boling Point | 262.4°C at 760 mmHg |
| Flash Point | 112.5°C |
| Water Solubility | 20 g/L (17℃) |
| Vapor Presure | 0.00323mmHg at 25°C |
| Appearance | White powder |
| Storage Condition | Room Temprature |
| MDL | MFCD00066439 |
| Physical and Chemical Properties | melting point 275-290°C |
| Use | Used as a biotin Intermediate |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S24/25 - Avoid contact with skin and eyes. |