| Name | 1,4-Cyclohexanedimethanol bis(2-ethylhexanoate) |
| Synonyms | cyclohexanedimethanolethylhexanoate 4-Cyclohexanedimethanol bis(2-ethylhexanoate) 1,4-CYCLOHEXANEDIMETHANOL BIS(2-ETHYLHEXANOATE) 1,4-Cyclohexanedimethanol bis(2-ethylhexanoate) cyclohexane-1,4-diylbismethylene bis(2-ethylhexanoate) cyclohexane-1,4-diyldimethanediyl bis(2-ethylhexanoate) Hexanoicacid,2-ethyl-,1,4-cyclohexanediylbis(methylene)ester 1,4-Cyclohexanedimethanol Bis(2-ethylhexanoate) (cis- and trans- mixture) 1,4-CyclohexanediMethanol Bis(2-ethylhexanoate) (cis- and trans- Mixture) 2-ethylhexanoic acid [4-[(2-ethyl-1-oxohexoxy)methyl]cyclohexyl]methyl ester |
| CAS | 53148-32-6 |
| EINECS | 258-392-6 |
| InChI | InChI=1/C24H44O4/c1-5-9-11-21(7-3)23(25)27-17-19-13-15-20(16-14-19)18-28-24(26)22(8-4)12-10-6-2/h19-22H,5-18H2,1-4H3 |
| Molecular Formula | C24H44O4 |
| Molar Mass | 396.6 |
| Density | 0.943±0.06 g/cm3(Predicted) |
| Boling Point | 457.2±18.0 °C(Predicted) |
| Flash Point | 213°C |
| Vapor Presure | 1.53E-08mmHg at 25°C |
| Storage Condition | Room Temprature |
| Refractive Index | 1.4530-1.4610 |
| MDL | MFCD00060063 |
| Use | 1, 4-cyclohexanedimethanol diisooctanate has good thermal stability and anti-oxidation, widely used in plasticizer, cosmetics, high-grade lubricating oil, etc. For example, it can be used as a valuable raw material for the preparation of advanced lubricating oils and lubricating esters for jet engines. In addition, it is also used for chemical fiber oil agent. |
| use | 1,4-cyclohexanedimethanol diisooctanate has good thermal stability and oxidation resistance, and is widely used in plasticizers. Cosmetics. High grade lubricants, etc. For example, it can be used as a high-grade lubricating oil for jet engines. Valuable raw material for lubricating esters. In addition, it is also used in chemical fiber oil agent. |
| EPA chemical information | information provided by: ofmpub.epa.gov (external link) |