| Name | 4-Chlorobenzoic acid hydrazide |
| Synonyms | INHd 15 NSC 54990 4-chlorobenzohydrazide 4-CHLOROBENZOIC HYDRAZIDE 4-Chlorobenzoic acid hydrazide 4-CHLOROBENZOIC ACID HYDRAZIDE 4-Chlorobenzenecarboxylic acid hydrazide 4-Chlorobenzoylhydrazine4-Chlorobenzoic Hydrazide 4-Chlorobenzohydrazide, 4-Chlorobenzenecarbohydrazide 4-Chlorobenzhydrazide, (4-Chlorobenzoic acid hydrazide) |
| CAS | 536-40-3 |
| EINECS | 208-632-0 |
| InChI | InChI=1/C7H7ClN2O/c8-6-3-1-5(2-4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| InChIKey | PKBGHORNUFQAAW-UHFFFAOYSA-N |
| Molecular Formula | C7H7ClN2O |
| Molar Mass | 170.6 |
| Density | 1.323 |
| Melting Point | 162-165 °C (lit.) |
| Boling Point | 170.60°C |
| Flash Point | 156.2°C |
| Solubility | soluble in Methanol |
| Vapor Presure | 4.99E-05mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Almost white |
| BRN | 511154 |
| pKa | 12.09±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.5618 (estimate) |
| MDL | MFCD00007603 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29280000 |
| Hazard Class | IRRITANT |