| Name | 3-Methylbenzoylacetonitrile |
| Synonyms | 3-Toluoylacetonitrile 3-TOLUOYLACETONITRILE 3-Methylbenzoylacetonitrile 3-METHYLBENZOYLACETONITRILE 3-OXO-3-M-TOLYLPROPANENITRILE 3-Methyl-b-oxo-benzenepropanenitrile 3-(3-Methylphenyl)-3-oxopropanenitrile 3-(3-METHYLPHENYL)-3-OXOPROPANENITRILE |
| CAS | 53882-81-8 |
| InChI | InChI=1/C10H9NO/c1-8-3-2-4-9(7-8)10(12)5-6-11/h2-4,7H,5H2,1H3 |
| Molecular Formula | C10H9NO |
| Molar Mass | 159.18 |
| Density | 1.081±0.06 g/cm3(Predicted) |
| Melting Point | 73 °C |
| Boling Point | 318.6±25.0 °C(Predicted) |
| Flash Point | 146.5°C |
| Vapor Presure | 0.000358mmHg at 25°C |
| BRN | 2717335 |
| pKa | 7.84±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.532 |
| MDL | MFCD00067922 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | 3439 |
| Hazard Class | 6.1 |
| Packing Group | III |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |