| Name | (Pentafluorophenyl)diphenylphosphine |
| Synonyms | DIPHENYL(PENTAFLUOROPHENYL)PHOSPHINE (PENTAFLUOROPHENYL)DIPHENYLPHOSPHINE Diphenyl(pentafluorophenyl)phosphine (Pentafluorophenyl)diphenylphosphine (pentafluorophenyl)(diphenyl)phosphane (2,3,4,5,6-pentafluorophenyl)(diphenyl)phosphine 1-(Diphenylphosphino)-2,3,4,5,6-pentafluorobenzene |
| CAS | 5525-95-1 |
| InChI | InChI=1/C18H10F5P/c19-13-14(20)16(22)18(17(23)15(13)21)24(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| Molecular Formula | C18H10F5P |
| Molar Mass | 352.24 |
| Melting Point | 71-72°C(lit.) |
| Boling Point | 353.7±42.0 °C(Predicted) |
| Flash Point | 167.7°C |
| Solubility | soluble in Chloroform |
| Vapor Presure | 7.18E-05mmHg at 25°C |
| Appearance | solid |
| Color | White to Almost white |
| Storage Condition | Inert atmosphere,Room Temperature |
| MDL | MFCD00000290 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29310099 |
| Hazard Class | IRRITANT |
| Uses | Pentafluorophenyldiphenylphosphine is an organic phosphine compound that can be used as an organic reagent. |