55745-70-5 - Names and Identifiers
| Name | 2,3-dihydrobenzofuran-5-carboxaldehyde
|
| Synonyms | AKOS MSC-0772 2,3-dihyro-1-benzofuran-5-carb 2,3-Dihydro-5-benzofurancarbox 2,3-DIHYDROBENZOFURAN-5-CARBALDEHYDE 2,3-DIBENZO[B]FURAN-5-CARBOXALDEHYDE 2,3-dihyro-1-benzofuran-5-carbaldehyde 2,3-dihydrobenzofuran-5-carboxaldehyde 2,3-DIHYDRO-1-BENZOFURAN-5-CARBALDEHYDE 2,3-Dihydrobenzo[b]furan-5-carbaldehyde 2,3-dihydro-1-benzofuran-5-carbaldehyde 5-Benzofurancarboxaldehyde, 2,3-dihydro- (6CI,9CI)
|
| CAS | 55745-70-5
|
| EINECS | 259-788-1 |
| InChI | InChI=1/C9H8O2/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-2,5-6H,3-4H2 |
55745-70-5 - Physico-chemical Properties
| Molecular Formula | C9H8O2
|
| Molar Mass | 148.16 |
| Density | 1.177 g/mL at 25 °C (lit.) |
| Melting Point | 191~193℃ |
| Boling Point | 88-89 °C/0.1 mmHg (lit.) |
| Flash Point | >230°F |
| Vapor Presure | 0.00452mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Light orange to Yellow |
| Storage Condition | 2-8°C(protect from light) |
| Refractive Index | n20/D 1.6000(lit.) |
| MDL | MFCD00068058 |
55745-70-5 - Risk and Safety
| Hazard Symbols | Xi - Irritant

|
| Risk Codes | 43 - May cause sensitization by skin contact
|
| Safety Description | 37/39 - Wear suitable gloves and eye/face protection
|
| WGK Germany | 3 |
| HS Code | 29329990 |
| Hazard Class | IRRITANT |
55745-70-5 - Introduction
2, is an organic compound with the chemical formula C9H8O2. The following is a description of its nature, use, preparation and safety information:
Nature:
-Appearance: 2, white to light yellow solid.
-Solubility: It is soluble in many organic solvents, such as ethanol, dimethyl sulfoxide and ether.
-Melting point: Its melting point is about 50-55°C.
-Stability: relatively stable at room temperature, but not stable under acidic conditions.
Use:
2, is widely used in the field of organic synthesis, commonly used in the synthesis of compounds containing furan ring and aldehyde group. Its aldehyde group can participate in various reactions, such as aldol condensation reaction, aldehyde group reduction reaction, etc.
Preparation Method:
2, there are many preparation methods of the pill, common methods include:
-Condensation reaction of furan end groups: Using appropriate aldehyde groups and furan compounds as raw materials, the condensation reaction is carried out under acidic conditions to generate 2.
-Furan: Oxidation of furan compounds in the presence of oxygen under the catalysis of a catalyst to generate 2.
Safety Information:
2. The specific safety information may vary by country and region. The following are some common safety information precautions:
- 2, should be stored in a dark, dry and well-ventilated place.
-Wear appropriate protective measures such as lab gloves, goggles and protective clothing when using.
-Avoid inhaling its powder or gas, avoid contact with skin, eyes and mucous membranes.
-In case of contact, rinse immediately with plenty of water and seek medical attention.
-When using or handling this compound, please follow the relevant local regulations and safety practices.
Last Update:2024-04-10 22:29:15