| Name | 5-iodo-1H-indazole |
| Synonyms | 5-IODOINDAZOLE 5-iodo-1H-indazole 5-Iodo-1H-indazole 5-IODO (1H)INDAZOLE 1H-Indazole, 5-iodo- 1H-indazole, 5-iodo- |
| CAS | 55919-82-9 |
| InChI | InChI=1/C7H5IN2/c8-6-1-2-7-5(3-6)4-9-10-7/h1-4H,(H,9,10) |
| Molecular Formula | C7H5IN2 |
| Molar Mass | 244.03 |
| Density | 2.082±0.06 g/cm3(Predicted) |
| Melting Point | 156 °C |
| Boling Point | 358.2±15.0 °C(Predicted) |
| Flash Point | 170.426°C |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | Crystalline Powder |
| Color | Yellow to brown to purple |
| pKa | 12.87±0.40(Predicted) |
| Storage Condition | 2-8°C(protect from light) |
| Refractive Index | 1.788 |
| MDL | MFCD07781642 |
| HS Code | 29339980 |
| introduction | based on the particularity of indazole ring, the research on indazole compounds in the pharmaceutical field is extremely active at present. 5-Iodine -1H-indazole is a common derivative and is an important intermediate in medicine and chemical industry. |
| synthesis method | taking 5-amino-1H-indazole as the starting material and reacting with potassium iodide to prepare the target compound 5-amino-1H-indazole. The synthesis reaction formula is as follows: |