| Name | 2-(3,4-Dihydroxyphenyl)-5-hydroxy-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside |
| Synonyms | nepitrin nepetin-7-glucoside Nepetin-7-glucoside 6-Methoxyluteolin 7-glucoside 6-Methoxyluteolin 7-O-glucoside 3'-Hydroxy-6-O-methylscutellarein 7-O-β-glucopyranoside 2-(3,4-Dihydroxyphenyl)-5-hydroxy-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside 5-Hydroxy-6-methoxy-2-(3,4-dihydroxyphenyl)-7-(β-D-glucopyranosyloxy)-4H-1-benzopyran-4-one 2-(3,4-Dihydroxyphenyl)-5-hydroxy-6-methoxy-7-(β-D-glucopyranosyloxy)-4H-1-benzopyran-4-one 2-(3,4-Dihydroxyphenyl)-7-(β-D-glucopyranosyloxy)-5-hydroxy-6-methoxy-4H-1-benzopyran-4-one 4H-1-benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-7-(beta-D-glucopyranosyloxy)-5-hydroxy-6-methoxy- |
| CAS | 569-90-4 |
| InChI | InChI=1/C22H22O12/c1-31-21-14(33-22-20(30)19(29)17(27)15(7-23)34-22)6-13-16(18(21)28)11(26)5-12(32-13)8-2-3-9(24)10(25)4-8/h2-6,15,17,19-20,22-25,27-30H,7H2,1H3/t15-,17-,19+,20-,22-/m1/s1 |
| Molecular Formula | C22H22O12 |
| Molar Mass | 478.4 |
| Density | 1.674 |
| Melting Point | 172-174°C |
| Boling Point | 844.7°C at 760 mmHg |
| Flash Point | 294.9°C |
| Solubility | Soluble in methanol, ethanol, slightly soluble in petroleum ether |
| Vapor Presure | 2.56E-30mmHg at 25°C |
| Appearance | Light yellow powder |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.715 |
| MDL | MFCD01662760 |
| Physical and Chemical Properties | Yellow crystal, soluble in methanol, ethanol, slightly soluble in petroleum ether, derived from the labiatae plant Salvia plebeia R.Br. The above ground part. |
| Reference Show more | 1. Zhang, Ying, et al. "Compounds identification in semen cuscutae by ultra-high-performance liquid chromatography (UPLCs) coupled to electrospray ionization mass spectrometry." Molecules 23.5 (2018): 1199.https://doi.org/10.3390/molecules23051199 |