| Name | 4-Bromo-4í-Propyl Biphenyl |
| Synonyms | Iodopropylbiphenyl Bromopropylbiphenyl 4-bromo-4'-propylbiphenyl 4-BROMO-4'-PROPYLBIPHENYL 4-Bromo-4í-Propyl Biphenyl 4-Bromo-4-n-propylbiphenyl 4-BROMO-4'-N-PROPYLBIPHENYL 4-n-propyl-4'-bromobiphenyl 4-BroMo-4'-propyl-1,1'-biphenyl 1,1'-Biphenyl,4-bromo-4'-propyl- 1-(4-broMophenyl)-4-propylbenzene |
| CAS | 58743-81-0 |
| InChI | InChI=1/C15H15Br/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(16)11-9-14/h4-11H,2-3H2,1H3 |
| Molecular Formula | C15H15Br |
| Molar Mass | 275.18 |
| Density | 1.249±0.06 g/cm3(Predicted) |
| Melting Point | 107-109°C |
| Boling Point | 349.5±21.0 °C(Predicted) |
| Flash Point | 161.8°C |
| Vapor Presure | 9.42E-05mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.574 |
| MDL | MFCD00060105 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| use | liquid crystal monomer synthesis raw material |