| Name | Di-pentafluorophenyl carbonate |
| Synonyms | DPFPC pentafluorophenyl carbonate Di-pentafluorophenyl carbonate Bis(pentafluorophenyl)carbonate bis(pentafluorophenyl) carbonate BIS(PENTATFLUOROPHENYL)CARBONATE DPFPC Bis(Pentafluorophenyl)Carbonate Carbonic Acid Bis(pentafluorophenyl) Ester |
| CAS | 59483-84-0 |
| EINECS | 671-619-7 |
| InChI | InChI=1/C13F10O3/c14-1-3(16)7(20)11(8(21)4(1)17)25-13(24)26-12-9(22)5(18)2(15)6(19)10(12)23 |
| InChIKey | IOVVFSGCNWQFQT-UHFFFAOYSA-N |
| Molecular Formula | C13F10O3 |
| Molar Mass | 394.12 |
| Density | 1.782±0.06 g/cm3(Predicted) |
| Melting Point | 47-50°C(lit.) |
| Boling Point | 250°C |
| Flash Point | 110 °C |
| Solubility | Soluble in chloroform, ethyl acetate and methylene chloride. |
| Vapor Presure | 0.00263mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Almost white |
| BRN | 2029727 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.447 |
| MDL | MFCD00368353 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29209090 |
| Hazard Class | IRRITANT |