| Name | (2-methylphenyl)(oxo)acetonitrile |
| Synonyms | 2-METHYLBENZOYL 2-Methylbenzoyl cyanide 2-METHYLBENZOYL CYANIDE OXO-O-TOLYL-ACETONITRILE 2-methyl phenyl glyoxylonitrile (2-methylphenyl)(oxo)acetonitrile Benzeneacetonitrile, 2-Methyl-a-oxo- Benzeneacetonitrile, 2-methyl-α-oxo- 2-(2-methylphenyl)-2-oxoacetonitrile |
| CAS | 5955-73-7 |
| EINECS | 200-258-5 |
| InChI | InChI=1/C9H7NO/c1-7-4-2-3-5-8(7)9(11)6-10/h2-5H,1H3 |
| Molecular Formula | C9H7NO |
| Molar Mass | 145.16 |
| Density | 1.111±0.06 g/cm3(Predicted) |
| Boling Point | 127 °C(Press: 29 Torr) |
| Flash Point | 98.481°C |
| Vapor Presure | 0.041mmHg at 25°C |
| Storage Condition | 2-8°C |
| Refractive Index | 1.541 |
| Physical and Chemical Properties | This product is viscous liquid, B. p.75 ~ 76 ℃/533pa, insoluble in water, soluble in ether, acetic acid, ethyl ester, acetonitrile and other solvents. |
| Use | O-methyl benzoyl nitrile is an intermediate of bactericide phenoxy Ester, trifloxystrobin, etc. |
| production method | the preparation method is that O-methylbenzoyl chloride is reacted with potassium cyanide in acetonitrile solvent, and the reaction is treated with ultrasonic wave, the reaction temperature was 50 ° C., ether was added to the reaction solution, the precipitate was filtered, the filtrate was dissolved to obtain the product, and then distilled to obtain a pure product. |