| Name | 6-Bromoveratraldehyde |
| Synonyms | AKOS B005109 TIMTEC-BB SBB003186 6-BROMOVEZATALDEHYDE 6-BROMOVERATRALDEHYDE 6-Bromoveratraldehyde 2-BROMO-4,5-DIMETHOXYBENZALEHYDE 4,5-Dimethoxy-2-bromobenzaldehyde 2-Bromo-4,5-dimethoxybenzaldehyde |
| CAS | 5392-10-9 |
| EINECS | 226-390-4 |
| InChI | InChI=1/C9H9BrO3/c1-12-8-3-6(5-11)7(10)4-9(8)13-2/h3-5H,1-2H3 |
| InChIKey | UQQROBHFUDBOOK-UHFFFAOYSA-N |
| Molecular Formula | C9H9BrO3 |
| Molar Mass | 245.07 |
| Density | 1.5955 (rough estimate) |
| Melting Point | 150-151 °C (lit.) |
| Boling Point | 316.1±37.0 °C(Predicted) |
| Flash Point | 145°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 0.000418mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Yellow to Orange |
| BRN | 2052355 |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Sensitive | Air Sensitive |
| Refractive Index | 1.4730 (estimate) |
| MDL | MFCD00003301 |
| Use | It was used in the preparation of benzylchromenylamines. |
| Hazard Symbols | Xi - Irritant![]() |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29124990 |
| Hazard Class | IRRITANT |
| use | 6-bromoveratrol is widely used in medicine, perfume, pesticide, chemical and organic synthesis industries |