| Name | 6(5H)-phenanthridinone |
| Synonyms | Phenantridone PHENANTHRIDONE Phenanthridinone PHENANTHRIDINONE 6-Phenanthridone 6-Phenanthridinol 6(5H)-Phenanthridone 6(5H)-Phenantridinone 6(5H)-phenanthridinone phenanthridin-6(5H)-one 2H-BENZ[C]ISOQUINOLIN-1-ONE |
| CAS | 1015-89-0 |
| EINECS | 213-804-3 |
| InChI | InChI=1/C13H9NO/c15-13-11-7-2-1-5-9(11)10-6-3-4-8-12(10)14-13/h1-8H,(H,14,15) |
| Molecular Formula | C13H9NO |
| Molar Mass | 195.22 |
| Density | 1.230±0.06 g/cm3(Predicted) |
| Melting Point | 290-292°C(lit.) |
| Boling Point | 435 °C |
| Flash Point | 158.663°C |
| Water Solubility | Soluble in DMSO (5 mg/ml). Insoluble in water. |
| Vapor Presure | 0.005mmHg at 25°C |
| Appearance | Crystalline powder |
| Color | White to Light yellow to Light orange |
| Maximum wavelength(λmax) | ['338nm(EtOH)(lit.)'] |
| BRN | 140641 |
| pKa | 13.27±0.20(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.642 |
| MDL | MFCD00004988 |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| RTECS | SG0370000 |
| HS Code | 29337900 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |