| Name | [(E)-phenyldiazenyl]propanedinitrile |
| Synonyms | Riociguat-25 (Phenylazo)Malonitrile Benzeneazomalononitrile BENZENEAZOMALONONITRILE (Phenylazo)Malononitrile 2-(Phenylazo)malononitrile Malononitrile, 2-phenylazo- Propanedinitrile, (phenylazo)- [(E)-phenyldiazenyl]propanedinitrile 2-(2-Phenyldiazenyl)propanedinitrile Benzeneazomalononitrile (Phenylazo)malonitrile |
| CAS | 6017-21-6 |
| EINECS | 1592732-453-0 |
| InChI | InChI=1/C9H6N4/c10-6-9(7-11)13-12-8-4-2-1-3-5-8/h1-5,9H/b13-12+ |
| Molecular Formula | C9H6N4 |
| Molar Mass | 170.17074 |
| Density | 1.12±0.1 g/cm3(Predicted) |
| Melting Point | >130°C (dec) |
| Boling Point | 260.7±30.0 °C(Predicted) |
| Flash Point | 111.5°C |
| Solubility | Chloroform, Dichloromethane, Ethyl Acetate, Methanol |
| Vapor Presure | 0.012mmHg at 25°C |
| Appearance | Solid |
| Color | Yellow |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.592 |
| Use | This product is for scientific research only and shall not be used for other purposes. |
| Use | phenylazo-malononitrile is an impurity, which is used as drug Standard reference substance, declaration and detection, etc. |