| Name | o-chlroiodobenzene |
| Synonyms | o-chlroiodobenzene O-IODOCHLOROBENZENE 2-CHLOROIODOBENZENE 2-Iodochlorobenzene 2-chloroiodobenzene O-CHLOROIODOBENZENE 2-Chlorophenyl iodide 1-chloro-2-iodobenzene 1-chloro-2-iodo-benzen 2-CHLORO-1-IODOBENZENE 1-Chloro-2-iodobenzene Benzene, 1-chloro-2-iodo- |
| CAS | 615-41-8 |
| EINECS | 210-423-4 |
| InChI | InChI=1/C6H4ClI/c7-5-3-1-2-4-6(5)8/h1-4H |
| Molecular Formula | C6H4ClI |
| Molar Mass | 238.45 |
| Density | 1.952 g/mL at 25 °C (lit.) |
| Melting Point | 1 °C (lit.) |
| Boling Point | 234-235 °C (lit.) |
| Flash Point | 233°F |
| Water Solubility | INSOLUBLE |
| Solubility | 0.069g/l |
| Vapor Presure | 0.0805mmHg at 25°C |
| Appearance | Liquid |
| Specific Gravity | 1.952 |
| Color | Clear slightly yellow |
| BRN | 1905116 |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Sensitive | Light Sensitive |
| Refractive Index | n20/D 1.6334(lit.) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S24/25 - Avoid contact with skin and eyes. |
| UN IDs | UN 2810 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 8 |
| TSCA | T |
| HS Code | 29036990 |
| Hazard Class | IRRITANT |
| Use | 1-chloro-2-iodobenzene is a reactant for the synthesis of sea cucumber alcohol biaryl derivatives and has anti-DPPH radical activity. |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |