| Name | glutamic acid 5-(3-carboxy-4-nitro-anilide) ammonium S |
| Synonyms | γ-GT Ammonium (S) H-GLA(PNA)-OH -2-nitrobenzoate H-GLA(PNA)-OH NH3 -5-(4-amino-4-carboxybutanamido) L-Glutamic acid γ-(3-carboxy-4-nitroanilide) glutamic acid 5-(3-carboxy-4-nitro-anilide) ammonium S γ-L-GlutaMyl-3-carboxy-4-nitroanilide, MonoaMMoniuM salt L-glutamic acid gamma-(3-carboxy-4-nitroanilide) ammonium salt L-GLUTAMIC ACID GAMMA-(3-CARBOXY-4-NITROANILIDE) AMMONIUM SALT Benzoic acid,5-[(4-aMino-4-carboxy-1-oxobutyl)aMino]-2-nitro-, MonoaMMoniuM salt, (S)- (9CI) |
| CAS | 63699-78-5 |
| EINECS | 264-418-7 |
| InChI | InChI=1/C12H13N3O7.H3N/c13-8(12(19)20)2-4-10(16)14-6-1-3-9(15(21)22)7(5-6)11(17)18;/h1,3,5,8H,2,4,13H2,(H,14,16)(H,17,18)(H,19,20);1H3 |
| Molecular Formula | C12H16N4O7 |
| Molar Mass | 328.28 |
| Boling Point | 685.7°C at 760 mmHg |
| Flash Point | 368.5°C |
| Solubility | H2O: 100mg/mL, clear, yellow-green |
| Vapor Presure | 9.54E-20mmHg at 25°C |
| Storage Condition | 2-8°C |
| MDL | MFCD00058243 |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29223990 |
| Biological activity | γ-GT(63699-78-5) is the substrate of γ-glutamyl transferase (glutamyl transferase). |