| Name | 3-Chloro-4-fluorobenzoyl chloride |
| Synonyms | SKL1302 GVR CG DF 65055-17-6 3-Chloro-4-fluorobenzoyl chloride 3-CHLORO-4-FLUOROBENZOYL CHLORIDE 3-Chloro-4-fluorobenzoyl Chloride Benzoyl chloride, 3-chloro-4-fluoro- Benzoyl chloride, 3-chloro-4-fluoro- (9CI) |
| CAS | 65055-17-6 |
| InChI | InChI=1/C7H3Cl2FO/c8-5-3-4(7(9)11)1-2-6(5)10/h1-3H |
| Molecular Formula | C7H3Cl2FO |
| Molar Mass | 193 |
| Density | 1.46 |
| Melting Point | 28 °C |
| Boling Point | 222 °C |
| Flash Point | 222°C |
| Vapor Presure | 0.142mmHg at 25°C |
| BRN | 6288904 |
| Storage Condition | Room Temprature |
| Sensitive | Moisture Sensitive |
| Refractive Index | 1.551 |
| MDL | MFCD00236215 |
| Risk Codes | R34 - Causes burns R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S27 - Take off immediately all contaminated clothing. |
| UN IDs | 3265 |
| HS Code | 29162090 |
| Hazard Note | Corrosive |
| Hazard Class | 8 |
| Packing Group | II |