| Name | (2,6-difluorophenyl)acetonitrile |
| Synonyms | TIMTEC-BB SBB006682 2,6-Difluorobenzylcyanide 2,6-DIFLUOROBENZYL CYANIDE 2,6-difluorophenylacetonitrile 2,6-DIFLUOROPHENYLACETONITRILE 2,6-Difluorobenzeneacetonitrile 3,5-dichloro-4-fluronitrobenzene (2,6-Difluorophenyl)acetonitrile (2,6-difluorophenyl)acetonitrile Benzeneacetonitrile,2,6-difluoro- |
| CAS | 654-01-3 |
| EINECS | 211-504-7 |
| InChI | InChI=1/C8H5F2N/c9-7-2-1-3-8(10)6(7)4-5-11/h1-3H,4H2 |
| InChIKey | GVAYBGQTAADLJS-UHFFFAOYSA-N |
| Molecular Formula | C8H5F2N |
| Molar Mass | 153.13 |
| Density | 1.238 g/mL at 25 °C (lit.) |
| Boling Point | 109°C 27mm |
| Flash Point | 128°F |
| Vapor Presure | 0.19mmHg at 25°C |
| Specific Gravity | 1.238 |
| Exposure Limit | NIOSH: IDLH 25 mg/m3 |
| BRN | 2614807 |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | n20/D 1.481(lit.) |
| Physical and Chemical Properties | Colorless liquid. Flash point 53 ℃, refractive index 1.4810, specific gravity 1.238. |
| Risk Codes | R10 - Flammable R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. R10/20/21/22 - |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S27 - Take off immediately all contaminated clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S16/36/37 - |
| UN IDs | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HS Code | 29269090 |
| Hazard Note | Toxic |
| Hazard Class | 6.1 |
| Packing Group | III |
| chemical properties | colorless liquid. Flash point 53 ℃, refractive index 1.4810, specific gravity 1.238. |
| uses | intermediates in medicine, pesticides and liquid crystal materials. |