| Name | 3,4-Dichlorobenzonitrile |
| Synonyms | 3,4-Dichlorobenzonit 3,4-Dichlorbenzonitril 3,4-Dichlorobenzonitrle 3,4-Dichlorobenzonitrile Benzonitrile, 3,4-dichloro- |
| CAS | 6574-99-8 |
| EINECS | 229-494-8 |
| InChI | InChI=1/C7H3Cl2N/c8-6-2-1-5(4-10)3-7(6)9/h1-3H |
| Molecular Formula | C7H3Cl2N |
| Molar Mass | 172.01 |
| Density | 1.40±0.1 g/cm3(Predicted) |
| Melting Point | 74-78 °C (lit.) |
| Boling Point | 129-130 °C(Press: 0.01 Torr) |
| Flash Point | 95°C |
| Water Solubility | Insoluble in water |
| Vapor Presure | 0.0498mmHg at 25°C |
| Appearance | Powder or Crystalline Powder |
| Color | White to brown |
| BRN | 2326352 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.583 |
| MDL | MFCD00016379 |
| Physical and Chemical Properties | White crystalline powder. Melting point 70-71 °c. |
| Use | Used as a pesticide intermediate |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | 3276 |
| WGK Germany | 2 |
| TSCA | N |
| HS Code | 29269090 |
| Hazard Note | Irritant/Toxic |
| Hazard Class | 6.1 |
| Packing Group | III |
| LogP | 2.8 at 21.5℃ |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| Use | use as pesticide intermediate |