| Name | 2-Bromo-4-methoxyphenylacetic acid |
| Synonyms | 2-broMo-4-Methoxyphenylacetci acid 2-Bromo-4-methoxyphenylacetic acid 2-BROMO-4-METHOXYPHENYLACETIC ACID Benzeneacetic acid,2-bromo-4-methoxy- benzeneacetic acid, 2-bromo-4-methoxy- 2-(2-BroMo-4-Methoxyphenyl)-acetic acid |
| CAS | 66916-99-2 |
| InChI | InChI=1/C9H9BrO3/c1-13-7-3-2-6(4-9(11)12)8(10)5-7/h2-3,5H,4H2,1H3,(H,11,12) |
| Molecular Formula | C9H9BrO3 |
| Molar Mass | 245.07 |
| Density | 1.560±0.06 g/cm3(Predicted) |
| Melting Point | 127-131 °C (lit.) |
| Boling Point | 353.6±27.0 °C(Predicted) |
| Flash Point | 167.6°C |
| Vapor Presure | 1.31E-05mmHg at 25°C |
| pKa | 4.20±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.572 |
| Risk Codes | R22 - Harmful if swallowed R50 - Very Toxic to aquatic organisms |
| Safety Description | S60 - This material and its container must be disposed of as hazardous waste. S61 - Avoid release to the environment. Refer to special instructions / safety data sheets. |
| UN IDs | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| HS Code | 29189900 |
| Hazard Class | 6.1 |
| Packing Group | Ⅲ |